About 8-iodo-1-benzazocine
8-iodo-1-benzazocine (PubChem CID 54001385) has the molecular formula C11H8IN
and a molecular weight of 281.10 g/mol. Its IUPAC name is 8-iodo-1-benzazocine.
Molecular Properties
| Compound Name | 8-iodo-1-benzazocine |
| PubChem CID | 54001385 |
| Molecular Formula | C11H8IN |
| Molecular Weight | 281.10 g/mol |
| Exact Mass | 280.97 |
| IUPAC Name | 8-iodo-1-benzazocine |
| SMILES | Ic1ccc2c(c1)C=CC=C/C=N\2 |
| InChI | InChI=1S/C11H8IN/c12-10-5-6-11-9(8-10)4-2-1-3-7-13-11/h1-8H/b2-1?,3-1?,4-2?,7-3?,9-4?,13-7-,13-11- |
| InChIKey | KLWCQGBUSTXHBI-QJSVGWDISA-N |
| XLogP | 3.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.10 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 8-iodo-1-benzazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-iodo-1-benzazocine?
The IUPAC name of 8-iodo-1-benzazocine (CID 54001385) is 8-iodo-1-benzazocine.
What is the SMILES notation for 8-iodo-1-benzazocine?
The canonical SMILES for 8-iodo-1-benzazocine is Ic1ccc2c(c1)C=CC=C/C=N\2.
What is the InChIKey of 8-iodo-1-benzazocine?
The InChIKey is KLWCQGBUSTXHBI-QJSVGWDISA-N. The full InChI is InChI=1S/C11H8IN/c12-10-5-6-11-9(8-10)4-2-1-3-7-13-11/h1-8H/b2-1?,3-1?,4-2?,7-3?,9-4?,13-7-,13-11-.
What are the key properties of 8-iodo-1-benzazocine?
8-iodo-1-benzazocine has a molecular weight of 281.10 g/mol, XLogP of 3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-iodo-1-benzazocine is sourced from PubChem (CID 54001385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).