About [1,2-dihydroxy-5-[methyl-bis(trimethylsilyloxy)silyl]pentan-3-yl] 2-methylprop-2-enoate
[1,2-dihydroxy-5-[methyl-bis(trimethylsilyloxy)silyl]pentan-3-yl] 2-methylprop-2-enoate (PubChem CID 54001473) has the molecular formula C16H36O6Si3
and a molecular weight of 408.72 g/mol. Its IUPAC name is [1,2-dihydroxy-5-[methyl-bis(trimethylsilyloxy)silyl]pentan-3-yl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [1,2-dihydroxy-5-[methyl-bis(trimethylsilyloxy)silyl]pentan-3-yl] 2-methylprop-2-enoate |
| PubChem CID | 54001473 |
| Molecular Formula | C16H36O6Si3 |
| Molecular Weight | 408.72 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [1,2-dihydroxy-5-[methyl-bis(trimethylsilyloxy)silyl]pentan-3-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)C(O)CO |
| InChI | InChI=1S/C16H36O6Si3/c1-13(2)16(19)20-15(14(18)12-17)10-11-25(9,21-23(3,4)5)22-24(6,7)8/h14-15,17-18H,1,10-12H2,2-9H3 |
| InChIKey | KLXXPHBYJHQTQK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.72 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [1,2-dihydroxy-5-[methyl-bis(trimethylsilyloxy)silyl]pentan-3-yl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,2-dihydroxy-5-[methyl-bis(trimethylsilyloxy)silyl]pentan-3-yl] 2-methylprop-2-enoate?
The IUPAC name of [1,2-dihydroxy-5-[methyl-bis(trimethylsilyloxy)silyl]pentan-3-yl] 2-methylprop-2-enoate (CID 54001473) is [1,2-dihydroxy-5-[methyl-bis(trimethylsilyloxy)silyl]pentan-3-yl] 2-methylprop-2-enoate.
What is the SMILES notation for [1,2-dihydroxy-5-[methyl-bis(trimethylsilyloxy)silyl]pentan-3-yl] 2-methylprop-2-enoate?
The canonical SMILES for [1,2-dihydroxy-5-[methyl-bis(trimethylsilyloxy)silyl]pentan-3-yl] 2-methylprop-2-enoate is C=C(C)C(=O)OC(CC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)C(O)CO.
What is the InChIKey of [1,2-dihydroxy-5-[methyl-bis(trimethylsilyloxy)silyl]pentan-3-yl] 2-methylprop-2-enoate?
The InChIKey is KLXXPHBYJHQTQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36O6Si3/c1-13(2)16(19)20-15(14(18)12-17)10-11-25(9,21-23(3,4)5)22-24(6,7)8/h14-15,17-18H,1,10-12H2,2-9H3.
What are the key properties of [1,2-dihydroxy-5-[methyl-bis(trimethylsilyloxy)silyl]pentan-3-yl] 2-methylprop-2-enoate?
[1,2-dihydroxy-5-[methyl-bis(trimethylsilyloxy)silyl]pentan-3-yl] 2-methylprop-2-enoate has a molecular weight of 408.72 g/mol, XLogP of 2.99, 11 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2-dihydroxy-5-[methyl-bis(trimethylsilyloxy)silyl]pentan-3-yl] 2-methylprop-2-enoate is sourced from PubChem (CID 54001473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).