About 3-(methylamino)butan-2-one;1-(methylamino)propan-2-one;4-methyl-3-(methylamino)pentan-2-one
3-(methylamino)butan-2-one;1-(methylamino)propan-2-one;4-methyl-3-(methylamino)pentan-2-one (PubChem CID 54001489) has the molecular formula C16H35N3O3
and a molecular weight of 317.47 g/mol. Its IUPAC name is 3-(methylamino)butan-2-one;1-(methylamino)propan-2-one;4-methyl-3-(methylamino)pentan-2-one.
Molecular Properties
| Compound Name | 3-(methylamino)butan-2-one;1-(methylamino)propan-2-one;4-methyl-3-(methylamino)pentan-2-one |
| PubChem CID | 54001489 |
| Molecular Formula | C16H35N3O3 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | 3-(methylamino)butan-2-one;1-(methylamino)propan-2-one;4-methyl-3-(methylamino)pentan-2-one |
| SMILES | CNC(C(C)=O)C(C)C.CNC(C)C(C)=O.CNCC(C)=O |
| InChI | InChI=1S/C7H15NO.C5H11NO.C4H9NO/c1-5(2)7(8-4)6(3)9;1-4(6-3)5(2)7;1-4(6)3-5-2/h5,7-8H,1-4H3;4,6H,1-3H3;5H,3H2,1-2H3 |
| InChIKey | KLYFDMSBUMRJOC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(methylamino)butan-2-one;1-(methylamino)propan-2-one;4-methyl-3-(methylamino)pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methylamino)butan-2-one;1-(methylamino)propan-2-one;4-methyl-3-(methylamino)pentan-2-one?
The IUPAC name of 3-(methylamino)butan-2-one;1-(methylamino)propan-2-one;4-methyl-3-(methylamino)pentan-2-one (CID 54001489) is 3-(methylamino)butan-2-one;1-(methylamino)propan-2-one;4-methyl-3-(methylamino)pentan-2-one.
What is the SMILES notation for 3-(methylamino)butan-2-one;1-(methylamino)propan-2-one;4-methyl-3-(methylamino)pentan-2-one?
The canonical SMILES for 3-(methylamino)butan-2-one;1-(methylamino)propan-2-one;4-methyl-3-(methylamino)pentan-2-one is CNC(C(C)=O)C(C)C.CNC(C)C(C)=O.CNCC(C)=O.
What is the InChIKey of 3-(methylamino)butan-2-one;1-(methylamino)propan-2-one;4-methyl-3-(methylamino)pentan-2-one?
The InChIKey is KLYFDMSBUMRJOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO.C5H11NO.C4H9NO/c1-5(2)7(8-4)6(3)9;1-4(6-3)5(2)7;1-4(6)3-5-2/h5,7-8H,1-4H3;4,6H,1-3H3;5H,3H2,1-2H3.
What are the key properties of 3-(methylamino)butan-2-one;1-(methylamino)propan-2-one;4-methyl-3-(methylamino)pentan-2-one?
3-(methylamino)butan-2-one;1-(methylamino)propan-2-one;4-methyl-3-(methylamino)pentan-2-one has a molecular weight of 317.47 g/mol, XLogP of 0.80, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methylamino)butan-2-one;1-(methylamino)propan-2-one;4-methyl-3-(methylamino)pentan-2-one is sourced from PubChem (CID 54001489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).