About 1-(4-phenylphenyl)-1,2,4-triazole
1-(4-phenylphenyl)-1,2,4-triazole (PubChem CID 54001494) has the molecular formula C14H11N3
and a molecular weight of 221.26 g/mol. Its IUPAC name is 1-(4-phenylphenyl)-1,2,4-triazole.
Molecular Properties
| Compound Name | 1-(4-phenylphenyl)-1,2,4-triazole |
| PubChem CID | 54001494 |
| Molecular Formula | C14H11N3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 1-(4-phenylphenyl)-1,2,4-triazole |
| SMILES | c1ccc(-c2ccc(-n3cncn3)cc2)cc1 |
| InChI | InChI=1S/C14H11N3/c1-2-4-12(5-3-1)13-6-8-14(9-7-13)17-11-15-10-16-17/h1-11H |
| InChIKey | KLYHSFXKCVFKNV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-phenylphenyl)-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-phenylphenyl)-1,2,4-triazole?
The IUPAC name of 1-(4-phenylphenyl)-1,2,4-triazole (CID 54001494) is 1-(4-phenylphenyl)-1,2,4-triazole.
What is the SMILES notation for 1-(4-phenylphenyl)-1,2,4-triazole?
The canonical SMILES for 1-(4-phenylphenyl)-1,2,4-triazole is c1ccc(-c2ccc(-n3cncn3)cc2)cc1.
What is the InChIKey of 1-(4-phenylphenyl)-1,2,4-triazole?
The InChIKey is KLYHSFXKCVFKNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3/c1-2-4-12(5-3-1)13-6-8-14(9-7-13)17-11-15-10-16-17/h1-11H.
What are the key properties of 1-(4-phenylphenyl)-1,2,4-triazole?
1-(4-phenylphenyl)-1,2,4-triazole has a molecular weight of 221.26 g/mol, XLogP of 2.93, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-phenylphenyl)-1,2,4-triazole is sourced from PubChem (CID 54001494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).