C14H19N5O — CID 54001530
1-(2,6-dimethylphenyl)-6-ethyl-4-(2-methylhydrazinyl)-1,3,5-triazin-2-one (PubChem CID 54001530) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-6-ethyl-4-(2-methylhydrazinyl)-1,3,5-triazin-2-one.
| Compound Name | 1-(2,6-dimethylphenyl)-6-ethyl-4-(2-methylhydrazinyl)-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 54001530 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-6-ethyl-4-(2-methylhydrazinyl)-1,3,5-triazin-2-one |
| SMILES | CCc1nc(NNC)nc(=O)n1-c1c(C)cccc1C |
| InChI | InChI=1S/C14H19N5O/c1-5-11-16-13(18-15-4)17-14(20)19(11)12-9(2)7-6-8-10(12)3/h6-8,15H,5H2,1-4H3,(H,17,18,20) |
| InChIKey | KLYXAWZAZYZLHI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|