C29H33FO2 — CID 54001558
phenyl 3-ethyl-4-[1-fluoro-2-methyl-3-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]benzoate (PubChem CID 54001558) has the molecular formula C29H33FO2 and a molecular weight of 432.58 g/mol. Its IUPAC name is phenyl 3-ethyl-4-[1-fluoro-2-methyl-3-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]benzoate.
| Compound Name | phenyl 3-ethyl-4-[1-fluoro-2-methyl-3-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]benzoate |
|---|---|
| PubChem CID | 54001558 |
| Molecular Formula | C29H33FO2 |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | phenyl 3-ethyl-4-[1-fluoro-2-methyl-3-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]benzoate |
| SMILES | C=C(C(C)=C(F)c1ccc(C(=O)Oc2ccccc2)cc1CC)C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C29H33FO2/c1-7-22-18-23(28(31)32-24-13-9-8-10-14-24)15-16-25(22)27(30)21(4)20(3)26-19(2)12-11-17-29(26,5)6/h8-10,13-16,18H,3,7,11-12,17H2,1-2,4-6H3 |
| InChIKey | KLZIFVPXUCPCNO-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|