C9H17NO2 — CID 54001881
3,3,5,5-tetradeuterio-1-hydroxy-2,2,6,6-tetrakis(trideuteriomethyl)piperidin-4-one (PubChem CID 54001881) has the molecular formula C9H17NO2 and a molecular weight of 187.34 g/mol. Its IUPAC name is 3,3,5,5-tetradeuterio-1-hydroxy-2,2,6,6-tetrakis(trideuteriomethyl)piperidin-4-one.
| Compound Name | 3,3,5,5-tetradeuterio-1-hydroxy-2,2,6,6-tetrakis(trideuteriomethyl)piperidin-4-one |
|---|---|
| PubChem CID | 54001881 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 187.34 g/mol |
| Exact Mass | 187.23 |
| IUPAC Name | 3,3,5,5-tetradeuterio-1-hydroxy-2,2,6,6-tetrakis(trideuteriomethyl)piperidin-4-one |
| SMILES | [2H]C([2H])([2H])C1(C([2H])([2H])[2H])N(O)C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])C(=O)C1([2H])[2H] |
| InChI | InChI=1S/C9H17NO2/c1-8(2)5-7(11)6-9(3,4)10(8)12/h12H,5-6H2,1-4H3/i1D3,2D3,3D3,4D3,5D2,6D2 |
| InChIKey | KMEUSKGEUADGET-NMRSHPDNSA-N |
| XLogP | 1.60 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |