C25H44N2O4 — CID 54002279
bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-methylidenebutanedioate (PubChem CID 54002279) has the molecular formula C25H44N2O4 and a molecular weight of 436.64 g/mol. Its IUPAC name is bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-methylidenebutanedioate.
| Compound Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 54002279 |
| Molecular Formula | C25H44N2O4 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.33 |
| IUPAC Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OC1CC(C)(C)N(C)C(C)(C)C1)C(=O)OC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C25H44N2O4/c1-17(21(29)31-19-15-24(6,7)27(11)25(8,9)16-19)12-20(28)30-18-13-22(2,3)26(10)23(4,5)14-18/h18-19H,1,12-16H2,2-11H3 |
| InChIKey | KMLDEOPQMFYECD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|