C7H8Cl2O6 — CID 54002289
(4R,5R)-4,5-dichloro-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylic acid (PubChem CID 54002289) has the molecular formula C7H8Cl2O6 and a molecular weight of 259.04 g/mol. Its IUPAC name is (4R,5R)-4,5-dichloro-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylic acid.
| Compound Name | (4R,5R)-4,5-dichloro-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 54002289 |
| Molecular Formula | C7H8Cl2O6 |
| Molecular Weight | 259.04 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | (4R,5R)-4,5-dichloro-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylic acid |
| SMILES | CC1(C)O[C@@](Cl)(C(=O)O)[C@](Cl)(C(=O)O)O1 |
| InChI | InChI=1S/C7H8Cl2O6/c1-5(2)14-6(8,3(10)11)7(9,15-5)4(12)13/h1-2H3,(H,10,11)(H,12,13)/t6-,7-/m0/s1 |
| InChIKey | KMLHIQKPMNOTAI-BQBZGAKWSA-N |
| XLogP | 0.81 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.04 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|