About ethyl 7-[(1S,6R)-6-(hydroxymethyl)cyclohex-3-en-1-yl]hept-5-enoate
ethyl 7-[(1S,6R)-6-(hydroxymethyl)cyclohex-3-en-1-yl]hept-5-enoate (PubChem CID 54002300) has the molecular formula C16H26O3
and a molecular weight of 266.38 g/mol. Its IUPAC name is ethyl 7-[(1S,6R)-6-(hydroxymethyl)cyclohex-3-en-1-yl]hept-5-enoate.
Molecular Properties
| Compound Name | ethyl 7-[(1S,6R)-6-(hydroxymethyl)cyclohex-3-en-1-yl]hept-5-enoate |
| PubChem CID | 54002300 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | ethyl 7-[(1S,6R)-6-(hydroxymethyl)cyclohex-3-en-1-yl]hept-5-enoate |
| SMILES | CCOC(=O)CCCC=CC[C@H]1CC=CC[C@H]1CO |
| InChI | InChI=1S/C16H26O3/c1-2-19-16(18)12-6-4-3-5-9-14-10-7-8-11-15(14)13-17/h3,5,7-8,14-15,17H,2,4,6,9-13H2,1H3/t14-,15-/m0/s1 |
| InChIKey | KMLKQJNLFJICTJ-GJZGRUSLSA-N |
| XLogP | 3.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 7-[(1S,6R)-6-(hydroxymethyl)cyclohex-3-en-1-yl]hept-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-[(1S,6R)-6-(hydroxymethyl)cyclohex-3-en-1-yl]hept-5-enoate?
The IUPAC name of ethyl 7-[(1S,6R)-6-(hydroxymethyl)cyclohex-3-en-1-yl]hept-5-enoate (CID 54002300) is ethyl 7-[(1S,6R)-6-(hydroxymethyl)cyclohex-3-en-1-yl]hept-5-enoate.
What is the SMILES notation for ethyl 7-[(1S,6R)-6-(hydroxymethyl)cyclohex-3-en-1-yl]hept-5-enoate?
The canonical SMILES for ethyl 7-[(1S,6R)-6-(hydroxymethyl)cyclohex-3-en-1-yl]hept-5-enoate is CCOC(=O)CCCC=CC[C@H]1CC=CC[C@H]1CO.
What is the InChIKey of ethyl 7-[(1S,6R)-6-(hydroxymethyl)cyclohex-3-en-1-yl]hept-5-enoate?
The InChIKey is KMLKQJNLFJICTJ-GJZGRUSLSA-N. The full InChI is InChI=1S/C16H26O3/c1-2-19-16(18)12-6-4-3-5-9-14-10-7-8-11-15(14)13-17/h3,5,7-8,14-15,17H,2,4,6,9-13H2,1H3/t14-,15-/m0/s1.
What are the key properties of ethyl 7-[(1S,6R)-6-(hydroxymethyl)cyclohex-3-en-1-yl]hept-5-enoate?
ethyl 7-[(1S,6R)-6-(hydroxymethyl)cyclohex-3-en-1-yl]hept-5-enoate has a molecular weight of 266.38 g/mol, XLogP of 3.24, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-[(1S,6R)-6-(hydroxymethyl)cyclohex-3-en-1-yl]hept-5-enoate is sourced from PubChem (CID 54002300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).