About N-buta-1,3-dienylacetamide
N-buta-1,3-dienylacetamide (PubChem CID 54002309) has the molecular formula C6H9NO
and a molecular weight of 111.14 g/mol. Its IUPAC name is N-buta-1,3-dienylacetamide.
Molecular Properties
| Compound Name | N-buta-1,3-dienylacetamide |
| PubChem CID | 54002309 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | N-buta-1,3-dienylacetamide |
| SMILES | C=CC=CNC(C)=O |
| InChI | InChI=1S/C6H9NO/c1-3-4-5-7-6(2)8/h3-5H,1H2,2H3,(H,7,8) |
| InChIKey | KMLONCKJQMYVCO-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.14 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-buta-1,3-dienylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-buta-1,3-dienylacetamide?
The IUPAC name of N-buta-1,3-dienylacetamide (CID 54002309) is N-buta-1,3-dienylacetamide.
What is the SMILES notation for N-buta-1,3-dienylacetamide?
The canonical SMILES for N-buta-1,3-dienylacetamide is C=CC=CNC(C)=O.
What is the InChIKey of N-buta-1,3-dienylacetamide?
The InChIKey is KMLONCKJQMYVCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO/c1-3-4-5-7-6(2)8/h3-5H,1H2,2H3,(H,7,8).
What are the key properties of N-buta-1,3-dienylacetamide?
N-buta-1,3-dienylacetamide has a molecular weight of 111.14 g/mol, XLogP of 0.82, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-buta-1,3-dienylacetamide is sourced from PubChem (CID 54002309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).