C22H23F2N3O — CID 54003214
1-(2,4-difluorophenyl)-1-[[1-(1-methylindol-3-yl)cyclopentyl]methyl]urea (PubChem CID 54003214) has the molecular formula C22H23F2N3O and a molecular weight of 383.44 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-1-[[1-(1-methylindol-3-yl)cyclopentyl]methyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-1-[[1-(1-methylindol-3-yl)cyclopentyl]methyl]urea |
|---|---|
| PubChem CID | 54003214 |
| Molecular Formula | C22H23F2N3O |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 1-(2,4-difluorophenyl)-1-[[1-(1-methylindol-3-yl)cyclopentyl]methyl]urea |
| SMILES | Cn1cc(C2(CN(C(N)=O)c3ccc(F)cc3F)CCCC2)c2ccccc21 |
| InChI | InChI=1S/C22H23F2N3O/c1-26-13-17(16-6-2-3-7-19(16)26)22(10-4-5-11-22)14-27(21(25)28)20-9-8-15(23)12-18(20)24/h2-3,6-9,12-13H,4-5,10-11,14H2,1H3,(H2,25,28) |
| InChIKey | KNBKTKNRYLRETO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |