About 5-phenyl-1,3,2-dioxathiane 2,2-dioxide
5-phenyl-1,3,2-dioxathiane 2,2-dioxide (PubChem CID 54003491) has the molecular formula C9H10O4S
and a molecular weight of 214.24 g/mol. Its IUPAC name is 5-phenyl-1,3,2-dioxathiane 2,2-dioxide.
Molecular Properties
| Compound Name | 5-phenyl-1,3,2-dioxathiane 2,2-dioxide |
| PubChem CID | 54003491 |
| Molecular Formula | C9H10O4S |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 5-phenyl-1,3,2-dioxathiane 2,2-dioxide |
| SMILES | O=S1(=O)OCC(c2ccccc2)CO1 |
| InChI | InChI=1S/C9H10O4S/c10-14(11)12-6-9(7-13-14)8-4-2-1-3-5-8/h1-5,9H,6-7H2 |
| InChIKey | KNGHRYJWQDEALN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-phenyl-1,3,2-dioxathiane 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-1,3,2-dioxathiane 2,2-dioxide?
The IUPAC name of 5-phenyl-1,3,2-dioxathiane 2,2-dioxide (CID 54003491) is 5-phenyl-1,3,2-dioxathiane 2,2-dioxide.
What is the SMILES notation for 5-phenyl-1,3,2-dioxathiane 2,2-dioxide?
The canonical SMILES for 5-phenyl-1,3,2-dioxathiane 2,2-dioxide is O=S1(=O)OCC(c2ccccc2)CO1.
What is the InChIKey of 5-phenyl-1,3,2-dioxathiane 2,2-dioxide?
The InChIKey is KNGHRYJWQDEALN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4S/c10-14(11)12-6-9(7-13-14)8-4-2-1-3-5-8/h1-5,9H,6-7H2.
What are the key properties of 5-phenyl-1,3,2-dioxathiane 2,2-dioxide?
5-phenyl-1,3,2-dioxathiane 2,2-dioxide has a molecular weight of 214.24 g/mol, XLogP of 1.06, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-1,3,2-dioxathiane 2,2-dioxide is sourced from PubChem (CID 54003491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).