C33H40N2O4S — CID 54003628
6,6-bis[2-(4-aminophenyl)ethyl]-3-[2-tert-butyl-4-(hydroxymethyl)-5-methylphenyl]sulfanyloxane-2,4-dione (PubChem CID 54003628) has the molecular formula C33H40N2O4S and a molecular weight of 560.76 g/mol. Its IUPAC name is 6,6-bis[2-(4-aminophenyl)ethyl]-3-[2-tert-butyl-4-(hydroxymethyl)-5-methylphenyl]sulfanyloxane-2,4-dione.
| Compound Name | 6,6-bis[2-(4-aminophenyl)ethyl]-3-[2-tert-butyl-4-(hydroxymethyl)-5-methylphenyl]sulfanyloxane-2,4-dione |
|---|---|
| PubChem CID | 54003628 |
| Molecular Formula | C33H40N2O4S |
| Molecular Weight | 560.76 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | 6,6-bis[2-(4-aminophenyl)ethyl]-3-[2-tert-butyl-4-(hydroxymethyl)-5-methylphenyl]sulfanyloxane-2,4-dione |
| SMILES | Cc1cc(SC2C(=O)CC(CCc3ccc(N)cc3)(CCc3ccc(N)cc3)OC2=O)c(C(C)(C)C)cc1CO |
| InChI | InChI=1S/C33H40N2O4S/c1-21-17-29(27(32(2,3)4)18-24(21)20-36)40-30-28(37)19-33(39-31(30)38,15-13-22-5-9-25(34)10-6-22)16-14-23-7-11-26(35)12-8-23/h5-12,17-18,30,36H,13-16,19-20,34-35H2,1-4H3 |
| InChIKey | KNIJZUYTWJLSDZ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.76 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|