About 6-[2-[2-(3,5-dimethylphenyl)-4,6-dimethylphenyl]ethenyl]-4-hydroxyoxan-2-one
6-[2-[2-(3,5-dimethylphenyl)-4,6-dimethylphenyl]ethenyl]-4-hydroxyoxan-2-one (PubChem CID 54003875) has the molecular formula C23H26O3
and a molecular weight of 350.46 g/mol. Its IUPAC name is 6-[2-[2-(3,5-dimethylphenyl)-4,6-dimethylphenyl]ethenyl]-4-hydroxyoxan-2-one.
Molecular Properties
| Compound Name | 6-[2-[2-(3,5-dimethylphenyl)-4,6-dimethylphenyl]ethenyl]-4-hydroxyoxan-2-one |
| PubChem CID | 54003875 |
| Molecular Formula | C23H26O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 6-[2-[2-(3,5-dimethylphenyl)-4,6-dimethylphenyl]ethenyl]-4-hydroxyoxan-2-one |
| SMILES | Cc1cc(C)cc(-c2cc(C)cc(C)c2C=CC2CC(O)CC(=O)O2)c1 |
| InChI | InChI=1S/C23H26O3/c1-14-7-15(2)10-18(9-14)22-11-16(3)8-17(4)21(22)6-5-20-12-19(24)13-23(25)26-20/h5-11,19-20,24H,12-13H2,1-4H3 |
| InChIKey | KNMFROHCOSXVOB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[2-[2-(3,5-dimethylphenyl)-4,6-dimethylphenyl]ethenyl]-4-hydroxyoxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-[2-(3,5-dimethylphenyl)-4,6-dimethylphenyl]ethenyl]-4-hydroxyoxan-2-one?
The IUPAC name of 6-[2-[2-(3,5-dimethylphenyl)-4,6-dimethylphenyl]ethenyl]-4-hydroxyoxan-2-one (CID 54003875) is 6-[2-[2-(3,5-dimethylphenyl)-4,6-dimethylphenyl]ethenyl]-4-hydroxyoxan-2-one.
What is the SMILES notation for 6-[2-[2-(3,5-dimethylphenyl)-4,6-dimethylphenyl]ethenyl]-4-hydroxyoxan-2-one?
The canonical SMILES for 6-[2-[2-(3,5-dimethylphenyl)-4,6-dimethylphenyl]ethenyl]-4-hydroxyoxan-2-one is Cc1cc(C)cc(-c2cc(C)cc(C)c2C=CC2CC(O)CC(=O)O2)c1.
What is the InChIKey of 6-[2-[2-(3,5-dimethylphenyl)-4,6-dimethylphenyl]ethenyl]-4-hydroxyoxan-2-one?
The InChIKey is KNMFROHCOSXVOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26O3/c1-14-7-15(2)10-18(9-14)22-11-16(3)8-17(4)21(22)6-5-20-12-19(24)13-23(25)26-20/h5-11,19-20,24H,12-13H2,1-4H3.
What are the key properties of 6-[2-[2-(3,5-dimethylphenyl)-4,6-dimethylphenyl]ethenyl]-4-hydroxyoxan-2-one?
6-[2-[2-(3,5-dimethylphenyl)-4,6-dimethylphenyl]ethenyl]-4-hydroxyoxan-2-one has a molecular weight of 350.46 g/mol, XLogP of 4.67, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-[2-(3,5-dimethylphenyl)-4,6-dimethylphenyl]ethenyl]-4-hydroxyoxan-2-one is sourced from PubChem (CID 54003875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).