C9H10N4O — CID 54004273
5-methyl-7-prop-2-enoxy-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 54004273) has the molecular formula C9H10N4O and a molecular weight of 190.21 g/mol. Its IUPAC name is 5-methyl-7-prop-2-enoxy-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 5-methyl-7-prop-2-enoxy-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 54004273 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 5-methyl-7-prop-2-enoxy-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | C=CCOc1cc(C)nc2ncnn12 |
| InChI | InChI=1S/C9H10N4O/c1-3-4-14-8-5-7(2)12-9-10-6-11-13(8)9/h3,5-6H,1,4H2,2H3 |
| InChIKey | KNSWWQOXYYWLCC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|