C56H104N8O16 — CID 54004346
5,8,14,17,23,26,32,35-octakis(2-methoxyethoxy)-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane (PubChem CID 54004346) has the molecular formula C56H104N8O16 and a molecular weight of 1145.49 g/mol. Its IUPAC name is 5,8,14,17,23,26,32,35-octakis(2-methoxyethoxy)-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane.
| Compound Name | 5,8,14,17,23,26,32,35-octakis(2-methoxyethoxy)-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
|---|---|
| PubChem CID | 54004346 |
| Molecular Formula | C56H104N8O16 |
| Molecular Weight | 1145.49 g/mol |
| Exact Mass | 1144.76 |
| IUPAC Name | 5,8,14,17,23,26,32,35-octakis(2-methoxyethoxy)-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
| SMILES | COCCOC1CCC(OCCOC)C2C3NC(NC4NC(NC5NC(NC6NC(N3)C3C(OCCOC)CCC(OCCOC)C63)C3C(OCCOC)CCC(OCCOC)C53)C3C(OCCOC)CCC(OCCOC)C43)C12 |
| InChI | InChI=1S/C56H104N8O16/c1-65-17-25-73-33-9-10-34(74-26-18-66-2)42-41(33)49-57-50(42)62-52-45-37(77-29-21-69-5)13-14-38(78-30-22-70-6)46(45)54(59-52)64-56-48-40(80-32-24-72-8)16-15-39(79-31-23-71-7)47(48)55(60-56)63-53-44-36(76-28-20-68-4)12-11-35(75-27-19-67-3)43(44)51(58-53)61-49/h33-64H,9-32H2,1-8H3 |
| InChIKey | LQKYHZUOLPGMBG-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 243.92 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1145.49 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|