About (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-3-phenylpropanoic acid
(2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-3-phenylpropanoic acid (PubChem CID 54004466) has the molecular formula C19H22N2O4
and a molecular weight of 342.39 g/mol. Its IUPAC name is (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-3-phenylpropanoic acid.
Molecular Properties
| Compound Name | (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-3-phenylpropanoic acid |
| PubChem CID | 54004466 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-3-phenylpropanoic acid |
| SMILES | N[C@H](Cc1ccccc1)[C@H](O)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H22N2O4/c20-15(11-13-7-3-1-4-8-13)17(22)18(23)21-16(19(24)25)12-14-9-5-2-6-10-14/h1-10,15-17,22H,11-12,20H2,(H,21,23)(H,24,25)/t15-,16+,17+/m1/s1 |
| InChIKey | KNWCAYPQYZZNGF-IKGGRYGDSA-N |
| XLogP | 0.73 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-3-phenylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-3-phenylpropanoic acid?
The IUPAC name of (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-3-phenylpropanoic acid (CID 54004466) is (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-3-phenylpropanoic acid.
What is the SMILES notation for (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-3-phenylpropanoic acid?
The canonical SMILES for (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-3-phenylpropanoic acid is N[C@H](Cc1ccccc1)[C@H](O)C(=O)N[C@@H](Cc1ccccc1)C(=O)O.
What is the InChIKey of (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-3-phenylpropanoic acid?
The InChIKey is KNWCAYPQYZZNGF-IKGGRYGDSA-N. The full InChI is InChI=1S/C19H22N2O4/c20-15(11-13-7-3-1-4-8-13)17(22)18(23)21-16(19(24)25)12-14-9-5-2-6-10-14/h1-10,15-17,22H,11-12,20H2,(H,21,23)(H,24,25)/t15-,16+,17+/m1/s1.
What are the key properties of (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-3-phenylpropanoic acid?
(2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-3-phenylpropanoic acid has a molecular weight of 342.39 g/mol, XLogP of 0.73, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-3-phenylpropanoic acid is sourced from PubChem (CID 54004466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).