C24H15F3N2O2S — CID 54004746
2-[2-methyl-5-phenyl-3-(4,5,7-trifluoro-1,3-benzothiazol-2-yl)indol-1-yl]acetic acid (PubChem CID 54004746) has the molecular formula C24H15F3N2O2S and a molecular weight of 452.46 g/mol. Its IUPAC name is 2-[2-methyl-5-phenyl-3-(4,5,7-trifluoro-1,3-benzothiazol-2-yl)indol-1-yl]acetic acid.
| Compound Name | 2-[2-methyl-5-phenyl-3-(4,5,7-trifluoro-1,3-benzothiazol-2-yl)indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 54004746 |
| Molecular Formula | C24H15F3N2O2S |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 2-[2-methyl-5-phenyl-3-(4,5,7-trifluoro-1,3-benzothiazol-2-yl)indol-1-yl]acetic acid |
| SMILES | Cc1c(-c2nc3c(F)c(F)cc(F)c3s2)c2cc(-c3ccccc3)ccc2n1CC(=O)O |
| InChI | InChI=1S/C24H15F3N2O2S/c1-12-20(24-28-22-21(27)16(25)10-17(26)23(22)32-24)15-9-14(13-5-3-2-4-6-13)7-8-18(15)29(12)11-19(30)31/h2-10H,11H2,1H3,(H,30,31) |
| InChIKey | KOBFGCSHZBLYOW-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|