About 1H-imidazol-2-yl N,N-diethylcarbamodithioate
1H-imidazol-2-yl N,N-diethylcarbamodithioate (PubChem CID 54005114) has the molecular formula C8H13N3S2
and a molecular weight of 215.35 g/mol. Its IUPAC name is 1H-imidazol-2-yl N,N-diethylcarbamodithioate.
Molecular Properties
| Compound Name | 1H-imidazol-2-yl N,N-diethylcarbamodithioate |
| PubChem CID | 54005114 |
| Molecular Formula | C8H13N3S2 |
| Molecular Weight | 215.35 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 1H-imidazol-2-yl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)Sc1ncc[nH]1 |
| InChI | InChI=1S/C8H13N3S2/c1-3-11(4-2)8(12)13-7-9-5-6-10-7/h5-6H,3-4H2,1-2H3,(H,9,10) |
| InChIKey | KOHTXJFLTPXXIQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1H-imidazol-2-yl N,N-diethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazol-2-yl N,N-diethylcarbamodithioate?
The IUPAC name of 1H-imidazol-2-yl N,N-diethylcarbamodithioate (CID 54005114) is 1H-imidazol-2-yl N,N-diethylcarbamodithioate.
What is the SMILES notation for 1H-imidazol-2-yl N,N-diethylcarbamodithioate?
The canonical SMILES for 1H-imidazol-2-yl N,N-diethylcarbamodithioate is CCN(CC)C(=S)Sc1ncc[nH]1.
What is the InChIKey of 1H-imidazol-2-yl N,N-diethylcarbamodithioate?
The InChIKey is KOHTXJFLTPXXIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3S2/c1-3-11(4-2)8(12)13-7-9-5-6-10-7/h5-6H,3-4H2,1-2H3,(H,9,10).
What are the key properties of 1H-imidazol-2-yl N,N-diethylcarbamodithioate?
1H-imidazol-2-yl N,N-diethylcarbamodithioate has a molecular weight of 215.35 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazol-2-yl N,N-diethylcarbamodithioate is sourced from PubChem (CID 54005114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).