About 1-(3,4-dichlorophenyl)-1-(1-ethoxyprop-2-enyl)-3,3-dimethylurea
1-(3,4-dichlorophenyl)-1-(1-ethoxyprop-2-enyl)-3,3-dimethylurea (PubChem CID 54005265) has the molecular formula C14H18Cl2N2O2
and a molecular weight of 317.22 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-1-(1-ethoxyprop-2-enyl)-3,3-dimethylurea.
Molecular Properties
| Compound Name | 1-(3,4-dichlorophenyl)-1-(1-ethoxyprop-2-enyl)-3,3-dimethylurea |
| PubChem CID | 54005265 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-1-(1-ethoxyprop-2-enyl)-3,3-dimethylurea |
| SMILES | C=CC(OCC)N(C(=O)N(C)C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H18Cl2N2O2/c1-5-13(20-6-2)18(14(19)17(3)4)10-7-8-11(15)12(16)9-10/h5,7-9,13H,1,6H2,2-4H3 |
| InChIKey | KOKNXYMDGGNFOO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,4-dichlorophenyl)-1-(1-ethoxyprop-2-enyl)-3,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dichlorophenyl)-1-(1-ethoxyprop-2-enyl)-3,3-dimethylurea?
The IUPAC name of 1-(3,4-dichlorophenyl)-1-(1-ethoxyprop-2-enyl)-3,3-dimethylurea (CID 54005265) is 1-(3,4-dichlorophenyl)-1-(1-ethoxyprop-2-enyl)-3,3-dimethylurea.
What is the SMILES notation for 1-(3,4-dichlorophenyl)-1-(1-ethoxyprop-2-enyl)-3,3-dimethylurea?
The canonical SMILES for 1-(3,4-dichlorophenyl)-1-(1-ethoxyprop-2-enyl)-3,3-dimethylurea is C=CC(OCC)N(C(=O)N(C)C)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 1-(3,4-dichlorophenyl)-1-(1-ethoxyprop-2-enyl)-3,3-dimethylurea?
The InChIKey is KOKNXYMDGGNFOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18Cl2N2O2/c1-5-13(20-6-2)18(14(19)17(3)4)10-7-8-11(15)12(16)9-10/h5,7-9,13H,1,6H2,2-4H3.
What are the key properties of 1-(3,4-dichlorophenyl)-1-(1-ethoxyprop-2-enyl)-3,3-dimethylurea?
1-(3,4-dichlorophenyl)-1-(1-ethoxyprop-2-enyl)-3,3-dimethylurea has a molecular weight of 317.22 g/mol, XLogP of 4.03, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dichlorophenyl)-1-(1-ethoxyprop-2-enyl)-3,3-dimethylurea is sourced from PubChem (CID 54005265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).