About 3-chloro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine
3-chloro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine (PubChem CID 54005358) has the molecular formula C8H10ClNS
and a molecular weight of 187.70 g/mol. Its IUPAC name is 3-chloro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine.
Molecular Properties
| Compound Name | 3-chloro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine |
| PubChem CID | 54005358 |
| Molecular Formula | C8H10ClNS |
| Molecular Weight | 187.70 g/mol |
| Exact Mass | 187.02 |
| IUPAC Name | 3-chloro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine |
| SMILES | NC1SC2C=CC=CC2C1Cl |
| InChI | InChI=1S/C8H10ClNS/c9-7-5-3-1-2-4-6(5)11-8(7)10/h1-8H,10H2 |
| InChIKey | SNGREEOMQBGMPZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.70 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine?
The IUPAC name of 3-chloro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine (CID 54005358) is 3-chloro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine.
What is the SMILES notation for 3-chloro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine?
The canonical SMILES for 3-chloro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine is NC1SC2C=CC=CC2C1Cl.
What is the InChIKey of 3-chloro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine?
The InChIKey is SNGREEOMQBGMPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClNS/c9-7-5-3-1-2-4-6(5)11-8(7)10/h1-8H,10H2.
What are the key properties of 3-chloro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine?
3-chloro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine has a molecular weight of 187.70 g/mol, XLogP of 1.74, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine is sourced from PubChem (CID 54005358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).