About S-(2-hydroxyethyl) 2-oxopropanethioate
S-(2-hydroxyethyl) 2-oxopropanethioate (PubChem CID 54005390) has the molecular formula C5H8O3S
and a molecular weight of 148.18 g/mol. Its IUPAC name is S-(2-hydroxyethyl) 2-oxopropanethioate.
Molecular Properties
| Compound Name | S-(2-hydroxyethyl) 2-oxopropanethioate |
| PubChem CID | 54005390 |
| Molecular Formula | C5H8O3S |
| Molecular Weight | 148.18 g/mol |
| Exact Mass | 148.02 |
| IUPAC Name | S-(2-hydroxyethyl) 2-oxopropanethioate |
| SMILES | CC(=O)C(=O)SCCO |
| InChI | InChI=1S/C5H8O3S/c1-4(7)5(8)9-3-2-6/h6H,2-3H2,1H3 |
| InChIKey | KOMVKQNGAIQMRS-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.18 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-hydroxyethyl) 2-oxopropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-hydroxyethyl) 2-oxopropanethioate?
The IUPAC name of S-(2-hydroxyethyl) 2-oxopropanethioate (CID 54005390) is S-(2-hydroxyethyl) 2-oxopropanethioate.
What is the SMILES notation for S-(2-hydroxyethyl) 2-oxopropanethioate?
The canonical SMILES for S-(2-hydroxyethyl) 2-oxopropanethioate is CC(=O)C(=O)SCCO.
What is the InChIKey of S-(2-hydroxyethyl) 2-oxopropanethioate?
The InChIKey is KOMVKQNGAIQMRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3S/c1-4(7)5(8)9-3-2-6/h6H,2-3H2,1H3.
What are the key properties of S-(2-hydroxyethyl) 2-oxopropanethioate?
S-(2-hydroxyethyl) 2-oxopropanethioate has a molecular weight of 148.18 g/mol, XLogP of -0.17, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-hydroxyethyl) 2-oxopropanethioate is sourced from PubChem (CID 54005390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).