About 2-chloro-1-N,1-N-diethyl-5-methylbenzene-1,4-diamine
2-chloro-1-N,1-N-diethyl-5-methylbenzene-1,4-diamine (PubChem CID 54005500) has the molecular formula C11H17ClN2
and a molecular weight of 212.72 g/mol. Its IUPAC name is 2-chloro-1-N,1-N-diethyl-5-methylbenzene-1,4-diamine.
Molecular Properties
| Compound Name | 2-chloro-1-N,1-N-diethyl-5-methylbenzene-1,4-diamine |
| PubChem CID | 54005500 |
| Molecular Formula | C11H17ClN2 |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 2-chloro-1-N,1-N-diethyl-5-methylbenzene-1,4-diamine |
| SMILES | CCN(CC)c1cc(C)c(N)cc1Cl |
| InChI | InChI=1S/C11H17ClN2/c1-4-14(5-2)11-6-8(3)10(13)7-9(11)12/h6-7H,4-5,13H2,1-3H3 |
| InChIKey | KOOWDKNMZSLLNQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1-N,1-N-diethyl-5-methylbenzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-N,1-N-diethyl-5-methylbenzene-1,4-diamine?
The IUPAC name of 2-chloro-1-N,1-N-diethyl-5-methylbenzene-1,4-diamine (CID 54005500) is 2-chloro-1-N,1-N-diethyl-5-methylbenzene-1,4-diamine.
What is the SMILES notation for 2-chloro-1-N,1-N-diethyl-5-methylbenzene-1,4-diamine?
The canonical SMILES for 2-chloro-1-N,1-N-diethyl-5-methylbenzene-1,4-diamine is CCN(CC)c1cc(C)c(N)cc1Cl.
What is the InChIKey of 2-chloro-1-N,1-N-diethyl-5-methylbenzene-1,4-diamine?
The InChIKey is KOOWDKNMZSLLNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClN2/c1-4-14(5-2)11-6-8(3)10(13)7-9(11)12/h6-7H,4-5,13H2,1-3H3.
What are the key properties of 2-chloro-1-N,1-N-diethyl-5-methylbenzene-1,4-diamine?
2-chloro-1-N,1-N-diethyl-5-methylbenzene-1,4-diamine has a molecular weight of 212.72 g/mol, XLogP of 3.08, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-N,1-N-diethyl-5-methylbenzene-1,4-diamine is sourced from PubChem (CID 54005500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).