C18H24O4 — CID 54005528
2-acetyl-3-oxo-5-(2,3,5,6-tetramethyl-3,6-dihydro-2H-pyran-4-yl)cyclohexene-1-carbaldehyde (PubChem CID 54005528) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-acetyl-3-oxo-5-(2,3,5,6-tetramethyl-3,6-dihydro-2H-pyran-4-yl)cyclohexene-1-carbaldehyde.
| Compound Name | 2-acetyl-3-oxo-5-(2,3,5,6-tetramethyl-3,6-dihydro-2H-pyran-4-yl)cyclohexene-1-carbaldehyde |
|---|---|
| PubChem CID | 54005528 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 2-acetyl-3-oxo-5-(2,3,5,6-tetramethyl-3,6-dihydro-2H-pyran-4-yl)cyclohexene-1-carbaldehyde |
| SMILES | CC(=O)C1=C(C=O)CC(C2=C(C)C(C)OC(C)C2C)CC1=O |
| InChI | InChI=1S/C18H24O4/c1-9-12(4)22-13(5)10(2)17(9)14-6-15(8-19)18(11(3)20)16(21)7-14/h8-9,12-14H,6-7H2,1-5H3 |
| InChIKey | NZRDFQFWCKOLAT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|