About 4-(diethoxymethyl)-2-methyl-1,3-dioxolane
4-(diethoxymethyl)-2-methyl-1,3-dioxolane (PubChem CID 54005776) has the molecular formula C9H18O4
and a molecular weight of 190.24 g/mol. Its IUPAC name is 4-(diethoxymethyl)-2-methyl-1,3-dioxolane.
Molecular Properties
| Compound Name | 4-(diethoxymethyl)-2-methyl-1,3-dioxolane |
| PubChem CID | 54005776 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 4-(diethoxymethyl)-2-methyl-1,3-dioxolane |
| SMILES | CCOC(OCC)C1COC(C)O1 |
| InChI | InChI=1S/C9H18O4/c1-4-10-9(11-5-2)8-6-12-7(3)13-8/h7-9H,4-6H2,1-3H3 |
| InChIKey | KOTXSXMOICCYLD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-(diethoxymethyl)-2-methyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(diethoxymethyl)-2-methyl-1,3-dioxolane?
The IUPAC name of 4-(diethoxymethyl)-2-methyl-1,3-dioxolane (CID 54005776) is 4-(diethoxymethyl)-2-methyl-1,3-dioxolane.
What is the SMILES notation for 4-(diethoxymethyl)-2-methyl-1,3-dioxolane?
The canonical SMILES for 4-(diethoxymethyl)-2-methyl-1,3-dioxolane is CCOC(OCC)C1COC(C)O1.
What is the InChIKey of 4-(diethoxymethyl)-2-methyl-1,3-dioxolane?
The InChIKey is KOTXSXMOICCYLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O4/c1-4-10-9(11-5-2)8-6-12-7(3)13-8/h7-9H,4-6H2,1-3H3.
What are the key properties of 4-(diethoxymethyl)-2-methyl-1,3-dioxolane?
4-(diethoxymethyl)-2-methyl-1,3-dioxolane has a molecular weight of 190.24 g/mol, XLogP of 1.15, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(diethoxymethyl)-2-methyl-1,3-dioxolane is sourced from PubChem (CID 54005776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).