C38H66O7 — CID 54005969
(3R,5S)-4-methoxy-3,5-dimethyl-6-[(3Z,5S,7S,8Z,11S,13S,15S,16Z)-2,6,12,14-tetramethoxy-3,5,7,9,11,13,15-heptamethylnonadeca-3,8,16,18-tetraenyl]oxan-2-one (PubChem CID 54005969) has the molecular formula C38H66O7 and a molecular weight of 634.94 g/mol. Its IUPAC name is (3R,5S)-4-methoxy-3,5-dimethyl-6-[(3Z,5S,7S,8Z,11S,13S,15S,16Z)-2,6,12,14-tetramethoxy-3,5,7,9,11,13,15-heptamethylnonadeca-3,8,16,18-tetraenyl]oxan-2-one.
| Compound Name | (3R,5S)-4-methoxy-3,5-dimethyl-6-[(3Z,5S,7S,8Z,11S,13S,15S,16Z)-2,6,12,14-tetramethoxy-3,5,7,9,11,13,15-heptamethylnonadeca-3,8,16,18-tetraenyl]oxan-2-one |
|---|---|
| PubChem CID | 54005969 |
| Molecular Formula | C38H66O7 |
| Molecular Weight | 634.94 g/mol |
| Exact Mass | 634.48 |
| IUPAC Name | (3R,5S)-4-methoxy-3,5-dimethyl-6-[(3Z,5S,7S,8Z,11S,13S,15S,16Z)-2,6,12,14-tetramethoxy-3,5,7,9,11,13,15-heptamethylnonadeca-3,8,16,18-tetraenyl]oxan-2-one |
| SMILES | C=C/C=C\[C@H](C)C(OC)[C@@H](C)C(OC)[C@@H](C)C/C(C)=C\[C@H](C)C(OC)[C@@H](C)/C=C(/C)C(CC1OC(=O)[C@H](C)C(OC)[C@H]1C)OC |
| InChI | InChI=1S/C38H66O7/c1-16-17-18-24(3)35(42-13)30(9)36(43-14)27(6)20-23(2)19-26(5)34(41-12)28(7)21-25(4)32(40-11)22-33-29(8)37(44-15)31(10)38(39)45-33/h16-19,21,24,26-37H,1,20,22H2,2-15H3/b18-17-,23-19-,25-21-/t24-,26-,27-,28-,29-,30+,31+,32?,33?,34?,35?,36?,37?/m0/s1 |
| InChIKey | KOXHJVANCRDAQF-DILSGGFUSA-N |
| XLogP | 7.85 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.94 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|