C32H50O5S — CID 54006208
[(1S,3S,9R,10R,13R,14R,17S)-3-acetyloxy-17-ethyl-3-(5-hydroxy-5-methylhexyl)sulfanyl-10,13-dimethyl-1,2,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-yl] acetate (PubChem CID 54006208) has the molecular formula C32H50O5S and a molecular weight of 546.81 g/mol. Its IUPAC name is [(1S,3S,9R,10R,13R,14R,17S)-3-acetyloxy-17-ethyl-3-(5-hydroxy-5-methylhexyl)sulfanyl-10,13-dimethyl-1,2,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-yl] acetate.
| Compound Name | [(1S,3S,9R,10R,13R,14R,17S)-3-acetyloxy-17-ethyl-3-(5-hydroxy-5-methylhexyl)sulfanyl-10,13-dimethyl-1,2,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-yl] acetate |
|---|---|
| PubChem CID | 54006208 |
| Molecular Formula | C32H50O5S |
| Molecular Weight | 546.81 g/mol |
| Exact Mass | 546.34 |
| IUPAC Name | [(1S,3S,9R,10R,13R,14R,17S)-3-acetyloxy-17-ethyl-3-(5-hydroxy-5-methylhexyl)sulfanyl-10,13-dimethyl-1,2,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-yl] acetate |
| SMILES | CC[C@H]1CC[C@H]2C3=CC=C4C[C@](OC(C)=O)(SCCCCC(C)(C)O)C[C@H](OC(C)=O)[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C32H50O5S/c1-8-23-12-14-26-25-13-11-24-19-32(37-22(3)34,38-18-10-9-16-29(4,5)35)20-28(36-21(2)33)31(24,7)27(25)15-17-30(23,26)6/h11,13,23,26-28,35H,8-10,12,14-20H2,1-7H3/t23-,26-,27+,28-,30+,31-,32-/m0/s1 |
| InChIKey | KPBAJYBLSVLZOG-HYYVUCBZSA-N |
| XLogP | 7.37 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.81 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|