About 4-chloro-N,1,3-trimethylpyrazol-5-amine
4-chloro-N,1,3-trimethylpyrazol-5-amine (PubChem CID 54006212) has the molecular formula C6H10ClN3
and a molecular weight of 159.62 g/mol. Its IUPAC name is 4-chloro-N,1,3-trimethylpyrazol-5-amine.
Molecular Properties
| Compound Name | 4-chloro-N,1,3-trimethylpyrazol-5-amine |
| PubChem CID | 54006212 |
| Molecular Formula | C6H10ClN3 |
| Molecular Weight | 159.62 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | 4-chloro-N,1,3-trimethylpyrazol-5-amine |
| SMILES | CNc1c(Cl)c(C)nn1C |
| InChI | InChI=1S/C6H10ClN3/c1-4-5(7)6(8-2)10(3)9-4/h8H,1-3H3 |
| InChIKey | KPBCYEGTMLRGQS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.62 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-N,1,3-trimethylpyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N,1,3-trimethylpyrazol-5-amine?
The IUPAC name of 4-chloro-N,1,3-trimethylpyrazol-5-amine (CID 54006212) is 4-chloro-N,1,3-trimethylpyrazol-5-amine.
What is the SMILES notation for 4-chloro-N,1,3-trimethylpyrazol-5-amine?
The canonical SMILES for 4-chloro-N,1,3-trimethylpyrazol-5-amine is CNc1c(Cl)c(C)nn1C.
What is the InChIKey of 4-chloro-N,1,3-trimethylpyrazol-5-amine?
The InChIKey is KPBCYEGTMLRGQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10ClN3/c1-4-5(7)6(8-2)10(3)9-4/h8H,1-3H3.
What are the key properties of 4-chloro-N,1,3-trimethylpyrazol-5-amine?
4-chloro-N,1,3-trimethylpyrazol-5-amine has a molecular weight of 159.62 g/mol, XLogP of 1.42, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N,1,3-trimethylpyrazol-5-amine is sourced from PubChem (CID 54006212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).