C18H16N2O9S — CID 54006288
2-(2,5-dihydroxy-3-sulfopyrrol-1-yl)-4-[4-(2,5-dioxopyrrol-1-yl)phenyl]butanoic acid (PubChem CID 54006288) has the molecular formula C18H16N2O9S and a molecular weight of 436.40 g/mol. Its IUPAC name is 2-(2,5-dihydroxy-3-sulfopyrrol-1-yl)-4-[4-(2,5-dioxopyrrol-1-yl)phenyl]butanoic acid.
| Compound Name | 2-(2,5-dihydroxy-3-sulfopyrrol-1-yl)-4-[4-(2,5-dioxopyrrol-1-yl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 54006288 |
| Molecular Formula | C18H16N2O9S |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 2-(2,5-dihydroxy-3-sulfopyrrol-1-yl)-4-[4-(2,5-dioxopyrrol-1-yl)phenyl]butanoic acid |
| SMILES | O=C(O)C(CCc1ccc(N2C(=O)C=CC2=O)cc1)n1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C18H16N2O9S/c21-14-7-8-15(22)19(14)11-4-1-10(2-5-11)3-6-12(18(25)26)20-16(23)9-13(17(20)24)30(27,28)29/h1-2,4-5,7-9,12,23-24H,3,6H2,(H,25,26)(H,27,28,29) |
| InChIKey | KPCIYJVKZUORGG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 174.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|