C27H35NO — CID 54006345
(1S,4aS,10aR)-N-benzyl-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide (PubChem CID 54006345) has the molecular formula C27H35NO and a molecular weight of 389.58 g/mol. Its IUPAC name is (1S,4aS,10aR)-N-benzyl-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide.
| Compound Name | (1S,4aS,10aR)-N-benzyl-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide |
|---|---|
| PubChem CID | 54006345 |
| Molecular Formula | C27H35NO |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | (1S,4aS,10aR)-N-benzyl-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide |
| SMILES | CC(C)c1ccc2c(c1)CC[C@H]1[C@@](C)(C(=O)NCc3ccccc3)CCC[C@]21C |
| InChI | InChI=1S/C27H35NO/c1-19(2)21-11-13-23-22(17-21)12-14-24-26(23,3)15-8-16-27(24,4)25(29)28-18-20-9-6-5-7-10-20/h5-7,9-11,13,17,19,24H,8,12,14-16,18H2,1-4H3,(H,28,29)/t24-,26-,27+/m1/s1 |
| InChIKey | KPDKVJZQFPLYRN-IEUSDUHPSA-N |
| XLogP | 6.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |