About 4-chloro-2-ethyl-2,3-dihydrothiophene
4-chloro-2-ethyl-2,3-dihydrothiophene (PubChem CID 54006609) has the molecular formula C6H9ClS
and a molecular weight of 148.66 g/mol. Its IUPAC name is 4-chloro-2-ethyl-2,3-dihydrothiophene.
Molecular Properties
| Compound Name | 4-chloro-2-ethyl-2,3-dihydrothiophene |
| PubChem CID | 54006609 |
| Molecular Formula | C6H9ClS |
| Molecular Weight | 148.66 g/mol |
| Exact Mass | 148.01 |
| IUPAC Name | 4-chloro-2-ethyl-2,3-dihydrothiophene |
| SMILES | CCC1CC(Cl)=CS1 |
| InChI | InChI=1S/C6H9ClS/c1-2-6-3-5(7)4-8-6/h4,6H,2-3H2,1H3 |
| InChIKey | KPHXMVXXZUYCAL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.66 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-2-ethyl-2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-ethyl-2,3-dihydrothiophene?
The IUPAC name of 4-chloro-2-ethyl-2,3-dihydrothiophene (CID 54006609) is 4-chloro-2-ethyl-2,3-dihydrothiophene.
What is the SMILES notation for 4-chloro-2-ethyl-2,3-dihydrothiophene?
The canonical SMILES for 4-chloro-2-ethyl-2,3-dihydrothiophene is CCC1CC(Cl)=CS1.
What is the InChIKey of 4-chloro-2-ethyl-2,3-dihydrothiophene?
The InChIKey is KPHXMVXXZUYCAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClS/c1-2-6-3-5(7)4-8-6/h4,6H,2-3H2,1H3.
What are the key properties of 4-chloro-2-ethyl-2,3-dihydrothiophene?
4-chloro-2-ethyl-2,3-dihydrothiophene has a molecular weight of 148.66 g/mol, XLogP of 2.98, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-ethyl-2,3-dihydrothiophene is sourced from PubChem (CID 54006609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).