C22H40Si — CID 54006672
dimethyl-bis[(2R)-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]silane (PubChem CID 54006672) has the molecular formula C22H40Si and a molecular weight of 332.65 g/mol. Its IUPAC name is dimethyl-bis[(2R)-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]silane.
| Compound Name | dimethyl-bis[(2R)-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]silane |
|---|---|
| PubChem CID | 54006672 |
| Molecular Formula | C22H40Si |
| Molecular Weight | 332.65 g/mol |
| Exact Mass | 332.29 |
| IUPAC Name | dimethyl-bis[(2R)-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]silane |
| SMILES | C[C@@H]1CC2CCCCC2C1[Si](C)(C)C1C2CCCCC2C[C@H]1C |
| InChI | InChI=1S/C22H40Si/c1-15-13-17-9-5-7-11-19(17)21(15)23(3,4)22-16(2)14-18-10-6-8-12-20(18)22/h15-22H,5-14H2,1-4H3/t15-,16-,17?,18?,19?,20?,21?,22?/m1/s1 |
| InChIKey | KPJHGXQOILNYAJ-XDNQUYSLSA-N |
| XLogP | 7.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.65 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|