About 5-(methylamino)hexane-1,2,3,4-tetrol
5-(methylamino)hexane-1,2,3,4-tetrol (PubChem CID 54006864) has the molecular formula C7H17NO4
and a molecular weight of 179.22 g/mol. Its IUPAC name is 5-(methylamino)hexane-1,2,3,4-tetrol.
Molecular Properties
| Compound Name | 5-(methylamino)hexane-1,2,3,4-tetrol |
| PubChem CID | 54006864 |
| Molecular Formula | C7H17NO4 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | 5-(methylamino)hexane-1,2,3,4-tetrol |
| SMILES | CNC(C)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C7H17NO4/c1-4(8-2)6(11)7(12)5(10)3-9/h4-12H,3H2,1-2H3 |
| InChIKey | VPEMKNKVOUTMBY-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(methylamino)hexane-1,2,3,4-tetrol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methylamino)hexane-1,2,3,4-tetrol?
The IUPAC name of 5-(methylamino)hexane-1,2,3,4-tetrol (CID 54006864) is 5-(methylamino)hexane-1,2,3,4-tetrol.
What is the SMILES notation for 5-(methylamino)hexane-1,2,3,4-tetrol?
The canonical SMILES for 5-(methylamino)hexane-1,2,3,4-tetrol is CNC(C)C(O)C(O)C(O)CO.
What is the InChIKey of 5-(methylamino)hexane-1,2,3,4-tetrol?
The InChIKey is VPEMKNKVOUTMBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17NO4/c1-4(8-2)6(11)7(12)5(10)3-9/h4-12H,3H2,1-2H3.
What are the key properties of 5-(methylamino)hexane-1,2,3,4-tetrol?
5-(methylamino)hexane-1,2,3,4-tetrol has a molecular weight of 179.22 g/mol, XLogP of -2.33, 5 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methylamino)hexane-1,2,3,4-tetrol is sourced from PubChem (CID 54006864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).