C22H37NO7S — CID 54007026
2,5-dihydroxy-1-octadec-9-enoyloxypyrrole-3-sulfonic acid (PubChem CID 54007026) has the molecular formula C22H37NO7S and a molecular weight of 459.61 g/mol. Its IUPAC name is 2,5-dihydroxy-1-octadec-9-enoyloxypyrrole-3-sulfonic acid.
| Compound Name | 2,5-dihydroxy-1-octadec-9-enoyloxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 54007026 |
| Molecular Formula | C22H37NO7S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 2,5-dihydroxy-1-octadec-9-enoyloxypyrrole-3-sulfonic acid |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)On1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C22H37NO7S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(25)30-23-20(24)18-19(22(23)26)31(27,28)29/h9-10,18,24,26H,2-8,11-17H2,1H3,(H,27,28,29) |
| InChIKey | KPPPEEBFUWLQHA-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 126.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|