C10H17F6NO — CID 54007115
2,6-dimethyl-4-(1,1,2,2,3-pentafluoropropyl)morpholine;fluoromethane (PubChem CID 54007115) has the molecular formula C10H17F6NO and a molecular weight of 281.24 g/mol. Its IUPAC name is 2,6-dimethyl-4-(1,1,2,2,3-pentafluoropropyl)morpholine;fluoromethane.
| Compound Name | 2,6-dimethyl-4-(1,1,2,2,3-pentafluoropropyl)morpholine;fluoromethane |
|---|---|
| PubChem CID | 54007115 |
| Molecular Formula | C10H17F6NO |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2,6-dimethyl-4-(1,1,2,2,3-pentafluoropropyl)morpholine;fluoromethane |
| SMILES | CC1CN(C(F)(F)C(F)(F)CF)CC(C)O1.CF |
| InChI | InChI=1S/C9H14F5NO.CH3F/c1-6-3-15(4-7(2)16-6)9(13,14)8(11,12)5-10;1-2/h6-7H,3-5H2,1-2H3;1H3 |
| InChIKey | KPRGCFVGUOKEOZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|