About 1-ethyl-2,4-dimethyl-5-(2-methylbutyl)imidazole
1-ethyl-2,4-dimethyl-5-(2-methylbutyl)imidazole (PubChem CID 54007160) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is 1-ethyl-2,4-dimethyl-5-(2-methylbutyl)imidazole.
Molecular Properties
| Compound Name | 1-ethyl-2,4-dimethyl-5-(2-methylbutyl)imidazole |
| PubChem CID | 54007160 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 1-ethyl-2,4-dimethyl-5-(2-methylbutyl)imidazole |
| SMILES | CCC(C)Cc1c(C)nc(C)n1CC |
| InChI | InChI=1S/C12H22N2/c1-6-9(3)8-12-10(4)13-11(5)14(12)7-2/h9H,6-8H2,1-5H3 |
| InChIKey | KPSABPGBJKQRIT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethyl-2,4-dimethyl-5-(2-methylbutyl)imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2,4-dimethyl-5-(2-methylbutyl)imidazole?
The IUPAC name of 1-ethyl-2,4-dimethyl-5-(2-methylbutyl)imidazole (CID 54007160) is 1-ethyl-2,4-dimethyl-5-(2-methylbutyl)imidazole.
What is the SMILES notation for 1-ethyl-2,4-dimethyl-5-(2-methylbutyl)imidazole?
The canonical SMILES for 1-ethyl-2,4-dimethyl-5-(2-methylbutyl)imidazole is CCC(C)Cc1c(C)nc(C)n1CC.
What is the InChIKey of 1-ethyl-2,4-dimethyl-5-(2-methylbutyl)imidazole?
The InChIKey is KPSABPGBJKQRIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2/c1-6-9(3)8-12-10(4)13-11(5)14(12)7-2/h9H,6-8H2,1-5H3.
What are the key properties of 1-ethyl-2,4-dimethyl-5-(2-methylbutyl)imidazole?
1-ethyl-2,4-dimethyl-5-(2-methylbutyl)imidazole has a molecular weight of 194.32 g/mol, XLogP of 3.11, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2,4-dimethyl-5-(2-methylbutyl)imidazole is sourced from PubChem (CID 54007160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).