C21H26O11S — CID 540072
[3,4,5-triacetyloxy-6-(4-methylphenyl)sulfonyloxan-2-yl]methyl acetate (PubChem CID 540072) has the molecular formula C21H26O11S and a molecular weight of 486.50 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-(4-methylphenyl)sulfonyloxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-(4-methylphenyl)sulfonyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 540072 |
| Molecular Formula | C21H26O11S |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | [3,4,5-triacetyloxy-6-(4-methylphenyl)sulfonyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(S(=O)(=O)c2ccc(C)cc2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C21H26O11S/c1-11-6-8-16(9-7-11)33(26,27)21-20(31-15(5)25)19(30-14(4)24)18(29-13(3)23)17(32-21)10-28-12(2)22/h6-9,17-21H,10H2,1-5H3 |
| InChIKey | HLDYKYDKXHGIPK-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|