C41H52N2O7 — CID 54007204
[(2R,3S,5R,6R)-6-(6-aminohexoxy)-2-(hydroxymethyl)-6-[2-(1H-indol-3-yl)ethyl]-5-(3-phenylpropanoyloxy)oxan-3-yl] 4-phenylbutanoate (PubChem CID 54007204) has the molecular formula C41H52N2O7 and a molecular weight of 684.87 g/mol. Its IUPAC name is [(2R,3S,5R,6R)-6-(6-aminohexoxy)-2-(hydroxymethyl)-6-[2-(1H-indol-3-yl)ethyl]-5-(3-phenylpropanoyloxy)oxan-3-yl] 4-phenylbutanoate.
| Compound Name | [(2R,3S,5R,6R)-6-(6-aminohexoxy)-2-(hydroxymethyl)-6-[2-(1H-indol-3-yl)ethyl]-5-(3-phenylpropanoyloxy)oxan-3-yl] 4-phenylbutanoate |
|---|---|
| PubChem CID | 54007204 |
| Molecular Formula | C41H52N2O7 |
| Molecular Weight | 684.87 g/mol |
| Exact Mass | 684.38 |
| IUPAC Name | [(2R,3S,5R,6R)-6-(6-aminohexoxy)-2-(hydroxymethyl)-6-[2-(1H-indol-3-yl)ethyl]-5-(3-phenylpropanoyloxy)oxan-3-yl] 4-phenylbutanoate |
| SMILES | NCCCCCCO[C@]1(CCc2c[nH]c3ccccc23)O[C@H](CO)[C@@H](OC(=O)CCCc2ccccc2)C[C@H]1OC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C41H52N2O7/c42-26-11-1-2-12-27-47-41(25-24-33-29-43-35-20-10-9-19-34(33)35)38(49-40(46)23-22-32-16-7-4-8-17-32)28-36(37(30-44)50-41)48-39(45)21-13-18-31-14-5-3-6-15-31/h3-10,14-17,19-20,29,36-38,43-44H,1-2,11-13,18,21-28,30,42H2/t36-,37+,38+,41+/m0/s1 |
| InChIKey | KPSQKYQUVZLXRO-QKSLWRRLSA-N |
| XLogP | 6.59 |
| TPSA | 133.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.87 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|