C16H17NS3 — CID 54007433
methyl N-methyl-2,2-bis(phenylsulfanyl)ethanimidothioate (PubChem CID 54007433) has the molecular formula C16H17NS3 and a molecular weight of 319.52 g/mol. Its IUPAC name is methyl N-methyl-2,2-bis(phenylsulfanyl)ethanimidothioate.
| Compound Name | methyl N-methyl-2,2-bis(phenylsulfanyl)ethanimidothioate |
|---|---|
| PubChem CID | 54007433 |
| Molecular Formula | C16H17NS3 |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | methyl N-methyl-2,2-bis(phenylsulfanyl)ethanimidothioate |
| SMILES | C/N=C(\SC)C(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C16H17NS3/c1-17-15(18-2)16(19-13-9-5-3-6-10-13)20-14-11-7-4-8-12-14/h3-12,16H,1-2H3/b17-15- |
| InChIKey | KPWQAOXMHHNTEE-ICFOKQHNSA-N |
| XLogP | 5.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|