C15H21NO6 — CID 54007803
methyl (2R)-2-methyl-10-(propan-2-ylcarbamoyloxy)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylate (PubChem CID 54007803) has the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. Its IUPAC name is methyl (2R)-2-methyl-10-(propan-2-ylcarbamoyloxy)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylate.
| Compound Name | methyl (2R)-2-methyl-10-(propan-2-ylcarbamoyloxy)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylate |
|---|---|
| PubChem CID | 54007803 |
| Molecular Formula | C15H21NO6 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | methyl (2R)-2-methyl-10-(propan-2-ylcarbamoyloxy)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylate |
| SMILES | COC(=O)C1=COC(OC(=O)NC(C)C)C2C1CC1O[C@@]12C |
| InChI | InChI=1S/C15H21NO6/c1-7(2)16-14(18)21-13-11-8(5-10-15(11,3)22-10)9(6-20-13)12(17)19-4/h6-8,10-11,13H,5H2,1-4H3,(H,16,18)/t8?,10?,11?,13?,15-/m0/s1 |
| InChIKey | KQCVNTZWXRMJFZ-RWGTZABXSA-N |
| XLogP | 1.33 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|