C12H18O4 — CID 54007942
(8S,10R)-4,4,8,10-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-9-one (PubChem CID 54007942) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is (8S,10R)-4,4,8,10-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-9-one.
| Compound Name | (8S,10R)-4,4,8,10-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-9-one |
|---|---|
| PubChem CID | 54007942 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (8S,10R)-4,4,8,10-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-9-one |
| SMILES | C[C@@H]1C(=O)[C@H](C)C2OC1C1OC(C)(C)OC12 |
| InChI | InChI=1S/C12H18O4/c1-5-7(13)6(2)9-11-10(8(5)14-9)15-12(3,4)16-11/h5-6,8-11H,1-4H3/t5-,6+,8?,9?,10?,11? |
| InChIKey | KQFKZIFXACDAQD-UFBBFYCESA-N |
| XLogP | 1.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |