C24H26N4 — CID 54008154
5,10,15,20-tetramethyl-1,2,3,4,21,23-hexahydroporphyrin (PubChem CID 54008154) has the molecular formula C24H26N4 and a molecular weight of 370.50 g/mol. Its IUPAC name is 5,10,15,20-tetramethyl-1,2,3,4,21,23-hexahydroporphyrin.
| Compound Name | 5,10,15,20-tetramethyl-1,2,3,4,21,23-hexahydroporphyrin |
|---|---|
| PubChem CID | 54008154 |
| Molecular Formula | C24H26N4 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 5,10,15,20-tetramethyl-1,2,3,4,21,23-hexahydroporphyrin |
| SMILES | CC1=C2C=CC(=N2)C(C)=c2ccc([nH]2)=C(C)C2=NC(=C(C)C3CCC1N3)C=C2 |
| InChI | InChI=1S/C24H26N4/c1-13-17-5-7-19(25-17)14(2)21-9-11-23(27-21)16(4)24-12-10-22(28-24)15(3)20-8-6-18(13)26-20/h5-9,11,22,24-25,28H,10,12H2,1-4H3 |
| InChIKey | GRJBLLQUPOGUMH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |