About N-(2,3-dimethylphenyl)-1-methyl-9H-pyrido[3,4-b]indole-3-carboxamide
N-(2,3-dimethylphenyl)-1-methyl-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 5400827) has the molecular formula C21H19N3O
and a molecular weight of 329.40 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-1-methyl-9H-pyrido[3,4-b]indole-3-carboxamide.
Molecular Properties
| Compound Name | N-(2,3-dimethylphenyl)-1-methyl-9H-pyrido[3,4-b]indole-3-carboxamide |
| PubChem CID | 5400827 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | N-(2,3-dimethylphenyl)-1-methyl-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cc3c([nH]c4ccccc43)c(C)n2)c1C |
| InChI | InChI=1S/C21H19N3O/c1-12-7-6-10-17(13(12)2)24-21(25)19-11-16-15-8-4-5-9-18(15)23-20(16)14(3)22-19/h4-11,23H,1-3H3,(H,24,25) |
| InChIKey | NMOFTYLBXGDJGZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2,3-dimethylphenyl)-1-methyl-9H-pyrido[3,4-b]indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dimethylphenyl)-1-methyl-9H-pyrido[3,4-b]indole-3-carboxamide?
The IUPAC name of N-(2,3-dimethylphenyl)-1-methyl-9H-pyrido[3,4-b]indole-3-carboxamide (CID 5400827) is N-(2,3-dimethylphenyl)-1-methyl-9H-pyrido[3,4-b]indole-3-carboxamide.
What is the SMILES notation for N-(2,3-dimethylphenyl)-1-methyl-9H-pyrido[3,4-b]indole-3-carboxamide?
The canonical SMILES for N-(2,3-dimethylphenyl)-1-methyl-9H-pyrido[3,4-b]indole-3-carboxamide is Cc1cccc(NC(=O)c2cc3c([nH]c4ccccc43)c(C)n2)c1C.
What is the InChIKey of N-(2,3-dimethylphenyl)-1-methyl-9H-pyrido[3,4-b]indole-3-carboxamide?
The InChIKey is NMOFTYLBXGDJGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O/c1-12-7-6-10-17(13(12)2)24-21(25)19-11-16-15-8-4-5-9-18(15)23-20(16)14(3)22-19/h4-11,23H,1-3H3,(H,24,25).
What are the key properties of N-(2,3-dimethylphenyl)-1-methyl-9H-pyrido[3,4-b]indole-3-carboxamide?
N-(2,3-dimethylphenyl)-1-methyl-9H-pyrido[3,4-b]indole-3-carboxamide has a molecular weight of 329.40 g/mol, XLogP of 4.89, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dimethylphenyl)-1-methyl-9H-pyrido[3,4-b]indole-3-carboxamide is sourced from PubChem (CID 5400827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).