C20H25N3 — CID 54008963
N,3,7-trimethyl-N-(3-methylphenyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide (PubChem CID 54008963) has the molecular formula C20H25N3 and a molecular weight of 307.44 g/mol. Its IUPAC name is N,3,7-trimethyl-N-(3-methylphenyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | N,3,7-trimethyl-N-(3-methylphenyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 54008963 |
| Molecular Formula | C20H25N3 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | N,3,7-trimethyl-N-(3-methylphenyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
| SMILES | [H]/N=C(/N(C)c1cccc(C)c1)N1Cc2cc(C)ccc2CC1C |
| InChI | InChI=1S/C20H25N3/c1-14-6-5-7-19(11-14)22(4)20(21)23-13-18-10-15(2)8-9-17(18)12-16(23)3/h5-11,16,21H,12-13H2,1-4H3/b21-20- |
| InChIKey | KQXZJJFMLRPDKC-MRCUWXFGSA-N |
| XLogP | 4.12 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|