About 7-azatricyclo[9.4.0.02,7]pentadeca-3,5-dien-8-one
7-azatricyclo[9.4.0.02,7]pentadeca-3,5-dien-8-one (PubChem CID 54009353) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is 7-azatricyclo[9.4.0.02,7]pentadeca-3,5-dien-8-one.
Molecular Properties
| Compound Name | 7-azatricyclo[9.4.0.02,7]pentadeca-3,5-dien-8-one |
| PubChem CID | 54009353 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 7-azatricyclo[9.4.0.02,7]pentadeca-3,5-dien-8-one |
| SMILES | O=C1CCC2CCCCC2C2C=CC=CN12 |
| InChI | InChI=1S/C14H19NO/c16-14-9-8-11-5-1-2-6-12(11)13-7-3-4-10-15(13)14/h3-4,7,10-13H,1-2,5-6,8-9H2 |
| InChIKey | KREPPEBLBXXUOY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-azatricyclo[9.4.0.02,7]pentadeca-3,5-dien-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-azatricyclo[9.4.0.02,7]pentadeca-3,5-dien-8-one?
The IUPAC name of 7-azatricyclo[9.4.0.02,7]pentadeca-3,5-dien-8-one (CID 54009353) is 7-azatricyclo[9.4.0.02,7]pentadeca-3,5-dien-8-one.
What is the SMILES notation for 7-azatricyclo[9.4.0.02,7]pentadeca-3,5-dien-8-one?
The canonical SMILES for 7-azatricyclo[9.4.0.02,7]pentadeca-3,5-dien-8-one is O=C1CCC2CCCCC2C2C=CC=CN12.
What is the InChIKey of 7-azatricyclo[9.4.0.02,7]pentadeca-3,5-dien-8-one?
The InChIKey is KREPPEBLBXXUOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO/c16-14-9-8-11-5-1-2-6-12(11)13-7-3-4-10-15(13)14/h3-4,7,10-13H,1-2,5-6,8-9H2.
What are the key properties of 7-azatricyclo[9.4.0.02,7]pentadeca-3,5-dien-8-one?
7-azatricyclo[9.4.0.02,7]pentadeca-3,5-dien-8-one has a molecular weight of 217.31 g/mol, XLogP of 2.87, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-azatricyclo[9.4.0.02,7]pentadeca-3,5-dien-8-one is sourced from PubChem (CID 54009353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).