About 7-amino-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one
7-amino-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one (PubChem CID 54009576) has the molecular formula C18H15N3O
and a molecular weight of 289.34 g/mol. Its IUPAC name is 7-amino-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one.
Molecular Properties
| Compound Name | 7-amino-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one |
| PubChem CID | 54009576 |
| Molecular Formula | C18H15N3O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 7-amino-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one |
| SMILES | Nc1ccc2nc3n(c(=O)c2c1)CCC3=Cc1ccccc1 |
| InChI | InChI=1S/C18H15N3O/c19-14-6-7-16-15(11-14)18(22)21-9-8-13(17(21)20-16)10-12-4-2-1-3-5-12/h1-7,10-11H,8-9,19H2 |
| InChIKey | KRILNOVCZVNXHJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one?
The IUPAC name of 7-amino-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one (CID 54009576) is 7-amino-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one.
What is the SMILES notation for 7-amino-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one?
The canonical SMILES for 7-amino-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one is Nc1ccc2nc3n(c(=O)c2c1)CCC3=Cc1ccccc1.
What is the InChIKey of 7-amino-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one?
The InChIKey is KRILNOVCZVNXHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3O/c19-14-6-7-16-15(11-14)18(22)21-9-8-13(17(21)20-16)10-12-4-2-1-3-5-12/h1-7,10-11H,8-9,19H2.
What are the key properties of 7-amino-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one?
7-amino-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one has a molecular weight of 289.34 g/mol, XLogP of 2.92, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-3-benzylidene-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one is sourced from PubChem (CID 54009576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).