About 6-[2-(diisocyanatomethyl)phenyl]hexane-1,1,1-triol
6-[2-(diisocyanatomethyl)phenyl]hexane-1,1,1-triol (PubChem CID 54009647) has the molecular formula C15H18N2O5
and a molecular weight of 306.32 g/mol. Its IUPAC name is 6-[2-(diisocyanatomethyl)phenyl]hexane-1,1,1-triol.
Molecular Properties
| Compound Name | 6-[2-(diisocyanatomethyl)phenyl]hexane-1,1,1-triol |
| PubChem CID | 54009647 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 6-[2-(diisocyanatomethyl)phenyl]hexane-1,1,1-triol |
| SMILES | O=C=NC(N=C=O)c1ccccc1CCCCCC(O)(O)O |
| InChI | InChI=1S/C15H18N2O5/c18-10-16-14(17-11-19)13-8-4-3-7-12(13)6-2-1-5-9-15(20,21)22/h3-4,7-8,14,20-22H,1-2,5-6,9H2 |
| InChIKey | KRJWUSSFNDFHGY-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-(diisocyanatomethyl)phenyl]hexane-1,1,1-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(diisocyanatomethyl)phenyl]hexane-1,1,1-triol?
The IUPAC name of 6-[2-(diisocyanatomethyl)phenyl]hexane-1,1,1-triol (CID 54009647) is 6-[2-(diisocyanatomethyl)phenyl]hexane-1,1,1-triol.
What is the SMILES notation for 6-[2-(diisocyanatomethyl)phenyl]hexane-1,1,1-triol?
The canonical SMILES for 6-[2-(diisocyanatomethyl)phenyl]hexane-1,1,1-triol is O=C=NC(N=C=O)c1ccccc1CCCCCC(O)(O)O.
What is the InChIKey of 6-[2-(diisocyanatomethyl)phenyl]hexane-1,1,1-triol?
The InChIKey is KRJWUSSFNDFHGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O5/c18-10-16-14(17-11-19)13-8-4-3-7-12(13)6-2-1-5-9-15(20,21)22/h3-4,7-8,14,20-22H,1-2,5-6,9H2.
What are the key properties of 6-[2-(diisocyanatomethyl)phenyl]hexane-1,1,1-triol?
6-[2-(diisocyanatomethyl)phenyl]hexane-1,1,1-triol has a molecular weight of 306.32 g/mol, XLogP of 1.09, 9 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(diisocyanatomethyl)phenyl]hexane-1,1,1-triol is sourced from PubChem (CID 54009647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).