C12H18O6 — CID 540097
4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-6-carbaldehyde (PubChem CID 540097) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is 4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-6-carbaldehyde.
| Compound Name | 4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-6-carbaldehyde |
|---|---|
| PubChem CID | 540097 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-6-carbaldehyde |
| SMILES | CC1(C)OC2COC3(C=O)OC(C)(C)OC3C2O1 |
| InChI | InChI=1S/C12H18O6/c1-10(2)15-7-5-14-12(6-13)9(8(7)16-10)17-11(3,4)18-12/h6-9H,5H2,1-4H3 |
| InChIKey | XQSPEQZXOJOPSF-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|