C21H31NO4S — CID 54009980
methyl (2S)-2-(N-[2-(3,3-dimethylbutanoylsulfanyl)acetyl]-2,3,6-trimethylanilino)propanoate (PubChem CID 54009980) has the molecular formula C21H31NO4S and a molecular weight of 393.55 g/mol. Its IUPAC name is methyl (2S)-2-(N-[2-(3,3-dimethylbutanoylsulfanyl)acetyl]-2,3,6-trimethylanilino)propanoate.
| Compound Name | methyl (2S)-2-(N-[2-(3,3-dimethylbutanoylsulfanyl)acetyl]-2,3,6-trimethylanilino)propanoate |
|---|---|
| PubChem CID | 54009980 |
| Molecular Formula | C21H31NO4S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | methyl (2S)-2-(N-[2-(3,3-dimethylbutanoylsulfanyl)acetyl]-2,3,6-trimethylanilino)propanoate |
| SMILES | COC(=O)[C@H](C)N(C(=O)CSC(=O)CC(C)(C)C)c1c(C)ccc(C)c1C |
| InChI | InChI=1S/C21H31NO4S/c1-13-9-10-14(2)19(15(13)3)22(16(4)20(25)26-8)17(23)12-27-18(24)11-21(5,6)7/h9-10,16H,11-12H2,1-8H3/t16-/m0/s1 |
| InChIKey | KRQCIVQGDMTBQT-INIZCTEOSA-N |
| XLogP | 4.20 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|